C17H26BF3NO4- — CID 161125337
(1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine;2,2,2-trifluoroacetate (PubChem CID 161125337) has the molecular formula C17H26BF3NO4- and a molecular weight of 376.20 g/mol. Its IUPAC name is (1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine;2,2,2-trifluoroacetate.
| Compound Name | (1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 161125337 |
| Molecular Formula | C17H26BF3NO4- |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1R)-2-cyclopropyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine;2,2,2-trifluoroacetate |
| SMILES | CC1(C)[C@@H]2C[C@H]3OB([C@@H](N)CC4CC4)O[C@@]3(C)[C@H]1C2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H26BNO2.C2HF3O2/c1-14(2)10-7-11(14)15(3)12(8-10)18-16(19-15)13(17)6-9-4-5-9;3-2(4,5)1(6)7/h9-13H,4-8,17H2,1-3H3;(H,6,7)/p-1/t10-,11-,12+,13-,15-;/m0./s1 |
| InChIKey | BMDVMWQSCNLZFG-CDVUYJLHSA-M |
| XLogP | 1.68 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|