C22H32N4O3 — CID 161128507
3-amino-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide;(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropan-1-amine (PubChem CID 161128507) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-amino-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide;(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropan-1-amine.
| Compound Name | 3-amino-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide;(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 161128507 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 3-amino-2-hydroxy-N,N,N'-trimethylbenzenecarboximidamide;(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropan-1-amine |
| SMILES | C/N=C(/c1cccc(N)c1O)N(C)C.CC(C)(C)[C@@H](N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17NO2.C10H15N3O/c1-12(2,3)11(13)8-4-5-9-10(6-8)15-7-14-9;1-12-10(13(2)3)7-5-4-6-8(11)9(7)14/h4-6,11H,7,13H2,1-3H3;4-6,14H,11H2,1-3H3/b;12-10-/t11-;/m0./s1 |
| InChIKey | ULWHATBXVNMGCN-GDPMSDRESA-N |
| XLogP | 3.37 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|