C27H37F3N4O3S — CID 161129310
1-[(3R,4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone (PubChem CID 161129310) has the molecular formula C27H37F3N4O3S and a molecular weight of 554.68 g/mol. Its IUPAC name is 1-[(3R,4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone.
| Compound Name | 1-[(3R,4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 161129310 |
| Molecular Formula | C27H37F3N4O3S |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 1-[(3R,4R)-4-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2,4-triazol-3-yl]-1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)[C@H]2CN(S(=O)(=O)C(F)(F)F)C[C@@H]2c2nnc(CCCC(C)(C)C)n2C2CC2)c(C)c1 |
| InChI | InChI=1S/C27H37F3N4O3S/c1-17-8-9-19(18(2)13-17)14-23(35)21-15-33(38(36,37)27(28,29)30)16-22(21)25-32-31-24(34(25)20-10-11-20)7-6-12-26(3,4)5/h8-9,13,20-22H,6-7,10-12,14-16H2,1-5H3/t21-,22-/m0/s1 |
| InChIKey | ULYXQWNXTODTLE-VXKWHMMOSA-N |
| XLogP | 5.28 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |