C46H66O13S2 — CID 161131614
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;tris(2,4,6-triethoxyphenyl)sulfanium (PubChem CID 161131614) has the molecular formula C46H66O13S2 and a molecular weight of 891.15 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;tris(2,4,6-triethoxyphenyl)sulfanium.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;tris(2,4,6-triethoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 161131614 |
| Molecular Formula | C46H66O13S2 |
| Molecular Weight | 891.15 g/mol |
| Exact Mass | 890.39 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate;tris(2,4,6-triethoxyphenyl)sulfanium |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)[O-])C(=O)C2.CCOc1cc(OCC)c([S+](c2c(OCC)cc(OCC)cc2OCC)c2c(OCC)cc(OCC)cc2OCC)c(OCC)c1 |
| InChI | InChI=1S/C36H51O9S.C10H16O4S/c1-10-37-25-19-28(40-13-4)34(29(20-25)41-14-5)46(35-30(42-15-6)21-26(38-11-2)22-31(35)43-16-7)36-32(44-17-8)23-27(39-12-3)24-33(36)45-18-9;1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14/h19-24H,10-18H2,1-9H3;7H,3-6H2,1-2H3,(H,12,13,14)/q+1;/p-1 |
| InChIKey | UMGOHAYIOUULKS-UHFFFAOYSA-M |
| XLogP | 9.30 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.15 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|