About (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid
(carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid (PubChem CID 161132102) has the molecular formula C13H16N2O4
and a molecular weight of 264.28 g/mol. Its IUPAC name is (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid.
Molecular Properties
| Compound Name | (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid |
| PubChem CID | 161132102 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid |
| SMILES | CC1(C)Cc2ccc(N(NC(=O)O)C(=O)O)cc2C1 |
| InChI | InChI=1S/C13H16N2O4/c1-13(2)6-8-3-4-10(5-9(8)7-13)15(12(18)19)14-11(16)17/h3-5,14H,6-7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | UMICOAVVRAAOOC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid?
The IUPAC name of (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid (CID 161132102) is (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid.
What is the SMILES notation for (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid?
The canonical SMILES for (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid is CC1(C)Cc2ccc(N(NC(=O)O)C(=O)O)cc2C1.
What is the InChIKey of (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid?
The InChIKey is UMICOAVVRAAOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-13(2)6-8-3-4-10(5-9(8)7-13)15(12(18)19)14-11(16)17/h3-5,14H,6-7H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid?
(carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid has a molecular weight of 264.28 g/mol, XLogP of 2.48, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (carboxyamino)-(2,2-dimethyl-1,3-dihydroinden-5-yl)carbamic acid is sourced from PubChem (CID 161132102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).