About N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine
N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine (PubChem CID 161133606) has the molecular formula C28H23N3
and a molecular weight of 401.51 g/mol. Its IUPAC name is N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine.
Molecular Properties
| Compound Name | N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine |
| PubChem CID | 161133606 |
| Molecular Formula | C28H23N3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine |
| SMILES | C(=NCc1ccccc1)=Nc1cccc2ccccc12.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H14N2.C10H9N/c1-2-7-15(8-3-1)13-19-14-20-18-12-6-10-16-9-4-5-11-17(16)18;11-10-7-3-5-8-4-1-2-6-9(8)10/h1-12H,13H2;1-7H,11H2 |
| InChIKey | UMMYBYAMHOXVFP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine?
The IUPAC name of N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine (CID 161133606) is N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine.
What is the SMILES notation for N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine?
The canonical SMILES for N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine is C(=NCc1ccccc1)=Nc1cccc2ccccc12.Nc1cccc2ccccc12.
What is the InChIKey of N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine?
The InChIKey is UMMYBYAMHOXVFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2.C10H9N/c1-2-7-15(8-3-1)13-19-14-20-18-12-6-10-16-9-4-5-11-17(16)18;11-10-7-3-5-8-4-1-2-6-9(8)10/h1-12H,13H2;1-7H,11H2.
What are the key properties of N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine?
N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine has a molecular weight of 401.51 g/mol, XLogP of 7.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-naphthalen-1-ylmethanediimine;naphthalen-1-amine is sourced from PubChem (CID 161133606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).