About lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid
lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid (PubChem CID 161134035) has the molecular formula C11H19LiN2O4S2
and a molecular weight of 314.36 g/mol. Its IUPAC name is lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid |
| PubChem CID | 161134035 |
| Molecular Formula | C11H19LiN2O4S2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid |
| SMILES | CC(C)[N-]C(C)C.NS(=O)(=O)c1ccc(C(=O)O)s1.[Li+] |
| InChI | InChI=1S/C6H14N.C5H5NO4S2.Li/c1-5(2)7-6(3)4;6-12(9,10)4-2-1-3(11-4)5(7)8;/h5-6H,1-4H3;1-2H,(H,7,8)(H2,6,9,10);/q-1;;+1 |
| InChIKey | UMOGIDMEUWECSS-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 111.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid?
The IUPAC name of lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid (CID 161134035) is lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid.
What is the SMILES notation for lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid?
The canonical SMILES for lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid is CC(C)[N-]C(C)C.NS(=O)(=O)c1ccc(C(=O)O)s1.[Li+].
What is the InChIKey of lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid?
The InChIKey is UMOGIDMEUWECSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N.C5H5NO4S2.Li/c1-5(2)7-6(3)4;6-12(9,10)4-2-1-3(11-4)5(7)8;/h5-6H,1-4H3;1-2H,(H,7,8)(H2,6,9,10);/q-1;;+1.
What are the key properties of lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid?
lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid has a molecular weight of 314.36 g/mol, XLogP of -0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;di(propan-2-yl)azanide;5-sulfamoylthiophene-2-carboxylic acid is sourced from PubChem (CID 161134035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).