C26H46N4+2 — CID 161134189
1-ethenyl-3-hexyl-2-methylimidazol-3-ium;1-ethenyl-2-methyl-3-octylimidazol-3-ium (PubChem CID 161134189) has the molecular formula C26H46N4+2 and a molecular weight of 414.68 g/mol. Its IUPAC name is 1-ethenyl-3-hexyl-2-methylimidazol-3-ium;1-ethenyl-2-methyl-3-octylimidazol-3-ium.
| Compound Name | 1-ethenyl-3-hexyl-2-methylimidazol-3-ium;1-ethenyl-2-methyl-3-octylimidazol-3-ium |
|---|---|
| PubChem CID | 161134189 |
| Molecular Formula | C26H46N4+2 |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.37 |
| IUPAC Name | 1-ethenyl-3-hexyl-2-methylimidazol-3-ium;1-ethenyl-2-methyl-3-octylimidazol-3-ium |
| SMILES | C=Cn1cc[n+](CCCCCC)c1C.C=Cn1cc[n+](CCCCCCCC)c1C |
| InChI | InChI=1S/C14H25N2.C12H21N2/c1-4-6-7-8-9-10-11-16-13-12-15(5-2)14(16)3;1-4-6-7-8-9-14-11-10-13(5-2)12(14)3/h5,12-13H,2,4,6-11H2,1,3H3;5,10-11H,2,4,6-9H2,1,3H3/q2*+1 |
| InChIKey | UMOSLWADPULLDL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|