About 2-methyl-1,3,2-benzodioxabismin-4-one
2-methyl-1,3,2-benzodioxabismin-4-one (PubChem CID 161134790) has the molecular formula C8H7BiO3
and a molecular weight of 360.12 g/mol. Its IUPAC name is 2-methyl-1,3,2-benzodioxabismin-4-one.
Molecular Properties
| Compound Name | 2-methyl-1,3,2-benzodioxabismin-4-one |
| PubChem CID | 161134790 |
| Molecular Formula | C8H7BiO3 |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-methyl-1,3,2-benzodioxabismin-4-one |
| SMILES | C[Bi]1OC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C7H6O3.CH3.Bi/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H,(H,9,10);1H3;/q;;+2/p-2 |
| InChIKey | CXWWPFPOSYSGOR-UHFFFAOYSA-L |
| XLogP | 1.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1,3,2-benzodioxabismin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3,2-benzodioxabismin-4-one?
The IUPAC name of 2-methyl-1,3,2-benzodioxabismin-4-one (CID 161134790) is 2-methyl-1,3,2-benzodioxabismin-4-one.
What is the SMILES notation for 2-methyl-1,3,2-benzodioxabismin-4-one?
The canonical SMILES for 2-methyl-1,3,2-benzodioxabismin-4-one is C[Bi]1OC(=O)c2ccccc2O1.
What is the InChIKey of 2-methyl-1,3,2-benzodioxabismin-4-one?
The InChIKey is CXWWPFPOSYSGOR-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O3.CH3.Bi/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H,(H,9,10);1H3;/q;;+2/p-2.
What are the key properties of 2-methyl-1,3,2-benzodioxabismin-4-one?
2-methyl-1,3,2-benzodioxabismin-4-one has a molecular weight of 360.12 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3,2-benzodioxabismin-4-one is sourced from PubChem (CID 161134790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).