C8H7BiO3 — CID 161134790
2-methyl-1,3,2-benzodioxabismin-4-one (PubChem CID 161134790) has the molecular formula C8H7BiO3 and a molecular weight of 360.12 g/mol. Its IUPAC name is 2-methyl-1,3,2-benzodioxabismin-4-one.
| Compound Name | 2-methyl-1,3,2-benzodioxabismin-4-one |
|---|---|
| PubChem CID | 161134790 |
| Molecular Formula | C8H7BiO3 |
| Molecular Weight | 360.12 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-methyl-1,3,2-benzodioxabismin-4-one |
| SMILES | C[Bi]1OC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C7H6O3.CH3.Bi/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4,8H,(H,9,10);1H3;/q;;+2/p-2 |
| InChIKey | CXWWPFPOSYSGOR-UHFFFAOYSA-L |
| XLogP | 1.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.12 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |