About sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one
sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one (PubChem CID 161134871) has the molecular formula C10H16NNaO3
and a molecular weight of 221.23 g/mol. Its IUPAC name is sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one |
| PubChem CID | 161134871 |
| Molecular Formula | C10H16NNaO3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one |
| SMILES | CC[O-].Cc1c[nH]c(CO)c(C)c1=O.[Na+] |
| InChI | InChI=1S/C8H11NO2.C2H5O.Na/c1-5-3-9-7(4-10)6(2)8(5)11;1-2-3;/h3,10H,4H2,1-2H3,(H,9,11);2H2,1H3;/q;-1;+1 |
| InChIKey | RECOKWPGSFOQOI-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 76.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
The IUPAC name of sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one (CID 161134871) is sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one.
What is the SMILES notation for sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
The canonical SMILES for sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one is CC[O-].Cc1c[nH]c(CO)c(C)c1=O.[Na+].
What is the InChIKey of sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
The InChIKey is RECOKWPGSFOQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2.C2H5O.Na/c1-5-3-9-7(4-10)6(2)8(5)11;1-2-3;/h3,10H,4H2,1-2H3,(H,9,11);2H2,1H3;/q;-1;+1.
What are the key properties of sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one?
sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one has a molecular weight of 221.23 g/mol, XLogP of -3.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethanolate;2-(hydroxymethyl)-3,5-dimethyl-1H-pyridin-4-one is sourced from PubChem (CID 161134871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).