C20H38O9 — CID 161135597
2,4,4-trimethylpentan-2-yloxy 2-[2-oxo-2-(2,4,4-trimethylpentan-2-yloxyperoxy)ethoxy]ethaneperoxoate (PubChem CID 161135597) has the molecular formula C20H38O9 and a molecular weight of 422.52 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yloxy 2-[2-oxo-2-(2,4,4-trimethylpentan-2-yloxyperoxy)ethoxy]ethaneperoxoate.
| Compound Name | 2,4,4-trimethylpentan-2-yloxy 2-[2-oxo-2-(2,4,4-trimethylpentan-2-yloxyperoxy)ethoxy]ethaneperoxoate |
|---|---|
| PubChem CID | 161135597 |
| Molecular Formula | C20H38O9 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yloxy 2-[2-oxo-2-(2,4,4-trimethylpentan-2-yloxyperoxy)ethoxy]ethaneperoxoate |
| SMILES | CC(C)(C)CC(C)(C)OOOC(=O)COCC(=O)OOOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H38O9/c1-17(2,3)13-19(7,8)26-28-24-15(21)11-23-12-16(22)25-29-27-20(9,10)14-18(4,5)6/h11-14H2,1-10H3 |
| InChIKey | UMTFGMRWBKWOAS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|