About (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium
(3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium (PubChem CID 161138793) has the molecular formula C31H35O3S+
and a molecular weight of 487.69 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium.
Molecular Properties
| Compound Name | (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium |
| PubChem CID | 161138793 |
| Molecular Formula | C31H35O3S+ |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium |
| SMILES | CC(=O)OCC12CC3CC(CC(O)(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H20O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(14)16-8-12-3-10-2-11(4-12)6-13(15,5-10)7-12/h1-15H;10-11,15H,2-8H2,1H3/q+1; |
| InChIKey | UNDQQHOERWXOTP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium?
The IUPAC name of (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium (CID 161138793) is (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium.
What is the SMILES notation for (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium?
The canonical SMILES for (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium is CC(=O)OCC12CC3CC(CC(O)(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium?
The InChIKey is UNDQQHOERWXOTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C13H20O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9(14)16-8-12-3-10-2-11(4-12)6-13(15,5-10)7-12/h1-15H;10-11,15H,2-8H2,1H3/q+1;.
What are the key properties of (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium?
(3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium has a molecular weight of 487.69 g/mol, XLogP of 6.66, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-adamantyl)methyl acetate;triphenylsulfanium is sourced from PubChem (CID 161138793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).