About 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine
1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine (PubChem CID 161139081) has the molecular formula C18H23BrN2
and a molecular weight of 347.30 g/mol. Its IUPAC name is 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine.
Molecular Properties
| Compound Name | 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine |
| PubChem CID | 161139081 |
| Molecular Formula | C18H23BrN2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine |
| SMILES | Cc1ccc(Br)cc1.Cc1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C11H16N2.C7H7Br/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13;1-6-2-4-7(8)5-3-6/h2-5,12H,6-9H2,1H3;2-5H,1H3 |
| InChIKey | UNEOQDMLTXCQPO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine?
The IUPAC name of 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine (CID 161139081) is 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine.
What is the SMILES notation for 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine?
The canonical SMILES for 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine is Cc1ccc(Br)cc1.Cc1ccc(N2CCNCC2)cc1.
What is the InChIKey of 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine?
The InChIKey is UNEOQDMLTXCQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.C7H7Br/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13;1-6-2-4-7(8)5-3-6/h2-5,12H,6-9H2,1H3;2-5H,1H3.
What are the key properties of 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine?
1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine has a molecular weight of 347.30 g/mol, XLogP of 4.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-methylbenzene;1-(4-methylphenyl)piperazine is sourced from PubChem (CID 161139081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).