About 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride
1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride (PubChem CID 16114) has the molecular formula C19H25Cl3N2
and a molecular weight of 387.78 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride.
Molecular Properties
| Compound Name | 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride |
| PubChem CID | 16114 |
| Molecular Formula | C19H25Cl3N2 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride |
| SMILES | C[NH+]1CCC[NH+](C(c2ccccc2)c2ccc(Cl)cc2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C19H23ClN2.2ClH/c1-21-12-5-13-22(15-14-21)19(16-6-3-2-4-7-16)17-8-10-18(20)11-9-17;;/h2-4,6-11,19H,5,12-15H2,1H3;2*1H |
| InChIKey | JLVFQWFTNVMTEG-UHFFFAOYSA-N |
| XLogP | -4.76 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride?
The IUPAC name of 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride (CID 16114) is 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride.
What is the SMILES notation for 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride?
The canonical SMILES for 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride is C[NH+]1CCC[NH+](C(c2ccccc2)c2ccc(Cl)cc2)CC1.[Cl-].[Cl-].
What is the InChIKey of 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride?
The InChIKey is JLVFQWFTNVMTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClN2.2ClH/c1-21-12-5-13-22(15-14-21)19(16-6-3-2-4-7-16)17-8-10-18(20)11-9-17;;/h2-4,6-11,19H,5,12-15H2,1H3;2*1H.
What are the key properties of 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride?
1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride has a molecular weight of 387.78 g/mol, XLogP of -4.76, 3 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-chlorophenyl)-phenylmethyl]-4-methyl-1,4-diazepane-1,4-diium dichloride is sourced from PubChem (CID 16114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).