C12H28N4O6S2 — CID 161140600
(4-ethylmorpholin-2-yl)methanesulfonamide;morpholin-2-ylmethanesulfonamide (PubChem CID 161140600) has the molecular formula C12H28N4O6S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (4-ethylmorpholin-2-yl)methanesulfonamide;morpholin-2-ylmethanesulfonamide.
| Compound Name | (4-ethylmorpholin-2-yl)methanesulfonamide;morpholin-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 161140600 |
| Molecular Formula | C12H28N4O6S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (4-ethylmorpholin-2-yl)methanesulfonamide;morpholin-2-ylmethanesulfonamide |
| SMILES | CCN1CCOC(CS(N)(=O)=O)C1.NS(=O)(=O)CC1CNCCO1 |
| InChI | InChI=1S/C7H16N2O3S.C5H12N2O3S/c1-2-9-3-4-12-7(5-9)6-13(8,10)11;6-11(8,9)4-5-3-7-1-2-10-5/h7H,2-6H2,1H3,(H2,8,10,11);5,7H,1-4H2,(H2,6,8,9) |
| InChIKey | UNJWJUOUMOPFEZ-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |