C11H16O2 — CID 161141262
6,6,7-trimethyloct-1-yne-3,5-dione (PubChem CID 161141262) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 6,6,7-trimethyloct-1-yne-3,5-dione.
| Compound Name | 6,6,7-trimethyloct-1-yne-3,5-dione |
|---|---|
| PubChem CID | 161141262 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6,6,7-trimethyloct-1-yne-3,5-dione |
| SMILES | C#CC(=O)CC(=O)C(C)(C)C(C)C |
| InChI | InChI=1S/C11H16O2/c1-6-9(12)7-10(13)11(4,5)8(2)3/h1,8H,7H2,2-5H3 |
| InChIKey | UNLZODQUIYZZHA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|