About 1,1'-biphenyl;pentanenitrile
1,1'-biphenyl;pentanenitrile (PubChem CID 161141924) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 1,1'-biphenyl;pentanenitrile.
Molecular Properties
| Compound Name | 1,1'-biphenyl;pentanenitrile |
| PubChem CID | 161141924 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1,1'-biphenyl;pentanenitrile |
| SMILES | CCCCC#N.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C5H9N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4-5-6/h1-10H;2-4H2,1H3 |
| InChIKey | UNOCCWWFDXPKOH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;pentanenitrile?
The IUPAC name of 1,1'-biphenyl;pentanenitrile (CID 161141924) is 1,1'-biphenyl;pentanenitrile.
What is the SMILES notation for 1,1'-biphenyl;pentanenitrile?
The canonical SMILES for 1,1'-biphenyl;pentanenitrile is CCCCC#N.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;pentanenitrile?
The InChIKey is UNOCCWWFDXPKOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C5H9N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-3-4-5-6/h1-10H;2-4H2,1H3.
What are the key properties of 1,1'-biphenyl;pentanenitrile?
1,1'-biphenyl;pentanenitrile has a molecular weight of 237.35 g/mol, XLogP of 5.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;pentanenitrile is sourced from PubChem (CID 161141924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).