About (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione
(4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione (PubChem CID 161141963) has the molecular formula C18H12Cl2O8
and a molecular weight of 427.19 g/mol. Its IUPAC name is (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione.
Molecular Properties
| Compound Name | (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione |
| PubChem CID | 161141963 |
| Molecular Formula | C18H12Cl2O8 |
| Molecular Weight | 427.19 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione |
| SMILES | O=C(OOC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1.O=C1CCC(=O)OO1 |
| InChI | InChI=1S/C14H8Cl2O4.C4H4O4/c15-11-5-1-9(2-6-11)13(17)19-20-14(18)10-3-7-12(16)8-4-10;5-3-1-2-4(6)8-7-3/h1-8H;1-2H2 |
| InChIKey | UNOGQQKVKAOZHB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione?
The IUPAC name of (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione (CID 161141963) is (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione.
What is the SMILES notation for (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione?
The canonical SMILES for (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione is O=C(OOC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1.O=C1CCC(=O)OO1.
What is the InChIKey of (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione?
The InChIKey is UNOGQQKVKAOZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2O4.C4H4O4/c15-11-5-1-9(2-6-11)13(17)19-20-14(18)10-3-7-12(16)8-4-10;5-3-1-2-4(6)8-7-3/h1-8H;1-2H2.
What are the key properties of (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione?
(4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione has a molecular weight of 427.19 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate;dioxane-3,6-dione is sourced from PubChem (CID 161141963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).