About (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide
(2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide (PubChem CID 161142137) has the molecular formula C9H17BrN2S
and a molecular weight of 265.22 g/mol. Its IUPAC name is (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide.
Molecular Properties
| Compound Name | (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide |
| PubChem CID | 161142137 |
| Molecular Formula | C9H17BrN2S |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide |
| SMILES | Br.CC(C)[C@H](CN)Cc1nccs1 |
| InChI | InChI=1S/C9H16N2S.BrH/c1-7(2)8(6-10)5-9-11-3-4-12-9;/h3-4,7-8H,5-6,10H2,1-2H3;1H/t8-;/m0./s1 |
| InChIKey | HFMUJZVDDKFKTD-QRPNPIFTSA-N |
| XLogP | 2.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide?
The IUPAC name of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide (CID 161142137) is (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide.
What is the SMILES notation for (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide?
The canonical SMILES for (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide is Br.CC(C)[C@H](CN)Cc1nccs1.
What is the InChIKey of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide?
The InChIKey is HFMUJZVDDKFKTD-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H16N2S.BrH/c1-7(2)8(6-10)5-9-11-3-4-12-9;/h3-4,7-8H,5-6,10H2,1-2H3;1H/t8-;/m0./s1.
What are the key properties of (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide?
(2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide has a molecular weight of 265.22 g/mol, XLogP of 2.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-methyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine;hydrobromide is sourced from PubChem (CID 161142137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).