C17H28N2O4 — CID 161142287
1-butylpiperazine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 161142287) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-butylpiperazine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 1-butylpiperazine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 161142287 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-butylpiperazine;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCN1CCNCC1 |
| InChI | InChI=1S/C9H10O4.C8H18N2/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-3-6-10-7-4-9-5-8-10/h2-4H,5H2,1H3,(H,10,11)(H,12,13);9H,2-8H2,1H3 |
| InChIKey | UNPJMJCMJGSHEI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |