C15H16ClN3O — CID 161143915
(2R)-2-[4-[(6-chloropyrimidin-4-yl)methyl]phenyl]morpholine (PubChem CID 161143915) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is (2R)-2-[4-[(6-chloropyrimidin-4-yl)methyl]phenyl]morpholine.
| Compound Name | (2R)-2-[4-[(6-chloropyrimidin-4-yl)methyl]phenyl]morpholine |
|---|---|
| PubChem CID | 161143915 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (2R)-2-[4-[(6-chloropyrimidin-4-yl)methyl]phenyl]morpholine |
| SMILES | Clc1cc(Cc2ccc([C@@H]3CNCCO3)cc2)ncn1 |
| InChI | InChI=1S/C15H16ClN3O/c16-15-8-13(18-10-19-15)7-11-1-3-12(4-2-11)14-9-17-5-6-20-14/h1-4,8,10,14,17H,5-7,9H2/t14-/m0/s1 |
| InChIKey | UNULILOHFICBEW-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |