About hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole (PubChem CID 161144656) has the molecular formula C9H12Cr2N2O7
and a molecular weight of 364.19 g/mol. Its IUPAC name is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole.
Molecular Properties
| Compound Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole |
| PubChem CID | 161144656 |
| Molecular Formula | C9H12Cr2N2O7 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole |
| SMILES | O=[Cr](=O)(O)O[Cr](=O)(=O)O.c1cc[nH]c1.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4H5N.2Cr.2H2O.5O/c1-2-4-6-5-3-1;1-2-4-5-3-1;;;;;;;;;/h1-5H;1-5H;;;2*1H2;;;;;/q;;2*+1;;;;;;;/p-2 |
| InChIKey | NRIJMAYAILCKCZ-UHFFFAOYSA-L |
| XLogP | 0.43 |
| TPSA | 146.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole?
The IUPAC name of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole (CID 161144656) is hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole.
What is the SMILES notation for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole?
The canonical SMILES for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole is O=[Cr](=O)(O)O[Cr](=O)(=O)O.c1cc[nH]c1.c1ccncc1.
What is the InChIKey of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole?
The InChIKey is NRIJMAYAILCKCZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H5N.C4H5N.2Cr.2H2O.5O/c1-2-4-6-5-3-1;1-2-4-5-3-1;;;;;;;;;/h1-5H;1-5H;;;2*1H2;;;;;/q;;2*+1;;;;;;;/p-2.
What are the key properties of hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole?
hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole has a molecular weight of 364.19 g/mol, XLogP of 0.43, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-(hydroxy(dioxo)chromio)oxy-dioxochromium;pyridine;1H-pyrrole is sourced from PubChem (CID 161144656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).