C12H18O4 — CID 161144944
(3aR,6R,7S,7aR)-2,2,7-trimethyl-6-prop-2-enyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one (PubChem CID 161144944) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (3aR,6R,7S,7aR)-2,2,7-trimethyl-6-prop-2-enyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one.
| Compound Name | (3aR,6R,7S,7aR)-2,2,7-trimethyl-6-prop-2-enyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one |
|---|---|
| PubChem CID | 161144944 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3aR,6R,7S,7aR)-2,2,7-trimethyl-6-prop-2-enyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one |
| SMILES | C=CC[C@H]1OC(=O)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C |
| InChI | InChI=1S/C12H18O4/c1-5-6-8-7(2)9-10(11(13)14-8)16-12(3,4)15-9/h5,7-10H,1,6H2,2-4H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | AJEDYKFANBAQSH-SGIHWFKDSA-N |
| XLogP | 1.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|