C48H52F6N10O6 — CID 161144984
2-amino-N-[2-[[(3R)-1-[(6-methyl-1H-indol-3-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide (PubChem CID 161144984) has the molecular formula C48H52F6N10O6 and a molecular weight of 979.00 g/mol. Its IUPAC name is 2-amino-N-[2-[[(3R)-1-[(6-methyl-1H-indol-3-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide.
| Compound Name | 2-amino-N-[2-[[(3R)-1-[(6-methyl-1H-indol-3-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 161144984 |
| Molecular Formula | C48H52F6N10O6 |
| Molecular Weight | 979.00 g/mol |
| Exact Mass | 978.40 |
| IUPAC Name | 2-amino-N-[2-[[(3R)-1-[(6-methyl-1H-indol-3-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide |
| SMILES | Cc1ccc2c(CN3CC[C@@H](NC(=O)CNC(=O)c4cc(OC(F)(F)F)ccc4N)C3)c[nH]c2c1.Cc1ccc2c(CN3CC[C@@H](NC(=O)CNC(=O)c4cc(OC(F)(F)F)ccc4N)C3)c[nH]c2c1 |
| InChI | InChI=1S/2C24H26F3N5O3/c2*1-14-2-4-18-15(10-29-21(18)8-14)12-32-7-6-16(13-32)31-22(33)11-30-23(34)19-9-17(3-5-20(19)28)35-24(25,26)27/h2*2-5,8-10,16,29H,6-7,11-13,28H2,1H3,(H,30,34)(H,31,33)/t2*16-/m11/s1 |
| InChIKey | UNXTTWMOQJLYQU-RWVWGXEFSA-N |
| XLogP | 6.16 |
| TPSA | 224.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.00 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|