C13H11NOS — CID 161145249
3-phenyl-5-thiophen-2-yl-4,5-dihydro-1,2-oxazole (PubChem CID 161145249) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-phenyl-5-thiophen-2-yl-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-phenyl-5-thiophen-2-yl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 161145249 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-phenyl-5-thiophen-2-yl-4,5-dihydro-1,2-oxazole |
| SMILES | c1ccc(C2=NOC(c3cccs3)C2)cc1 |
| InChI | InChI=1S/C13H11NOS/c1-2-5-10(6-3-1)11-9-12(15-14-11)13-7-4-8-16-13/h1-8,12H,9H2 |
| InChIKey | UNYOXYSVMFFCTR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |