About 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane
1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane (PubChem CID 161145625) has the molecular formula C16H24O10
and a molecular weight of 376.36 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane |
| PubChem CID | 161145625 |
| Molecular Formula | C16H24O10 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane |
| SMILES | C.C.CCOC(=O)CC(=O)OCOC(=O)c1cc(C(C)OO)cc(=O)o1 |
| InChI | InChI=1S/C14H16O10.2CH4/c1-3-20-11(15)6-12(16)21-7-22-14(18)10-4-9(8(2)24-19)5-13(17)23-10;;/h4-5,8,19H,3,6-7H2,1-2H3;2*1H4 |
| InChIKey | UNZWRQBLQZHZLX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane?
The IUPAC name of 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane (CID 161145625) is 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane.
What is the SMILES notation for 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane?
The canonical SMILES for 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane is C.C.CCOC(=O)CC(=O)OCOC(=O)c1cc(C(C)OO)cc(=O)o1.
What is the InChIKey of 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane?
The InChIKey is UNZWRQBLQZHZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O10.2CH4/c1-3-20-11(15)6-12(16)21-7-22-14(18)10-4-9(8(2)24-19)5-13(17)23-10;;/h4-5,8,19H,3,6-7H2,1-2H3;2*1H4.
What are the key properties of 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane?
1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane has a molecular weight of 376.36 g/mol, XLogP of 2.07, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-[[4-(1-hydroperoxyethyl)-6-oxopyran-2-carbonyl]oxymethyl] propanedioate;methane is sourced from PubChem (CID 161145625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).