About 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde
4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde (PubChem CID 161145970) has the molecular formula C23H22O3
and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde.
Molecular Properties
| Compound Name | 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde |
| PubChem CID | 161145970 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde |
| SMILES | Cc1ccc(C=O)cc1.Cc1ccc(COc2cccc(C=O)c2)cc1 |
| InChI | InChI=1S/C15H14O2.C8H8O/c1-12-5-7-13(8-6-12)11-17-15-4-2-3-14(9-15)10-16;1-7-2-4-8(6-9)5-3-7/h2-10H,11H2,1H3;2-6H,1H3 |
| InChIKey | UOAYVYNOVBAGJO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde?
The IUPAC name of 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde (CID 161145970) is 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde.
What is the SMILES notation for 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde?
The canonical SMILES for 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde is Cc1ccc(C=O)cc1.Cc1ccc(COc2cccc(C=O)c2)cc1.
What is the InChIKey of 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde?
The InChIKey is UOAYVYNOVBAGJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2.C8H8O/c1-12-5-7-13(8-6-12)11-17-15-4-2-3-14(9-15)10-16;1-7-2-4-8(6-9)5-3-7/h2-10H,11H2,1H3;2-6H,1H3.
What are the key properties of 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde?
4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde has a molecular weight of 346.43 g/mol, XLogP of 5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzaldehyde;3-[(4-methylphenyl)methoxy]benzaldehyde is sourced from PubChem (CID 161145970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).