C33H32F10N2O10 — CID 161146107
tert-butyl 4-methyl-2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxopentanoate;4-methyl-1-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pentane-1,3-dione (PubChem CID 161146107) has the molecular formula C33H32F10N2O10 and a molecular weight of 806.60 g/mol. Its IUPAC name is tert-butyl 4-methyl-2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxopentanoate;4-methyl-1-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pentane-1,3-dione.
| Compound Name | tert-butyl 4-methyl-2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxopentanoate;4-methyl-1-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pentane-1,3-dione |
|---|---|
| PubChem CID | 161146107 |
| Molecular Formula | C33H32F10N2O10 |
| Molecular Weight | 806.60 g/mol |
| Exact Mass | 806.19 |
| IUPAC Name | tert-butyl 4-methyl-2-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzoyl]-3-oxopentanoate;4-methyl-1-[2-nitro-4-(1,1,2,2,2-pentafluoroethyl)phenyl]pentane-1,3-dione |
| SMILES | CC(C)C(=O)C(C(=O)OC(C)(C)C)C(=O)c1ccc(C(F)(F)C(F)(F)F)cc1[N+](=O)[O-].CC(C)C(=O)CC(=O)c1ccc(C(F)(F)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20F5NO6.C14H12F5NO4/c1-9(2)14(26)13(16(28)31-17(3,4)5)15(27)11-7-6-10(8-12(11)25(29)30)18(20,21)19(22,23)24;1-7(2)11(21)6-12(22)9-4-3-8(5-10(9)20(23)24)13(15,16)14(17,18)19/h6-9,13H,1-5H3;3-5,7H,6H2,1-2H3 |
| InChIKey | UOBLTUYBYSJLRC-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 180.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.60 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|