C34H25Br2NO — CID 161146179
benzaldehyde;4,5-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;pyren-1-amine (PubChem CID 161146179) has the molecular formula C34H25Br2NO and a molecular weight of 623.39 g/mol. Its IUPAC name is benzaldehyde;4,5-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;pyren-1-amine.
| Compound Name | benzaldehyde;4,5-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;pyren-1-amine |
|---|---|
| PubChem CID | 161146179 |
| Molecular Formula | C34H25Br2NO |
| Molecular Weight | 623.39 g/mol |
| Exact Mass | 621.03 |
| IUPAC Name | benzaldehyde;4,5-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene;pyren-1-amine |
| SMILES | Brc1cc2c(cc1Br)C1C=CC2C1.Nc1ccc2ccc3cccc4ccc1c2c34.O=Cc1ccccc1 |
| InChI | InChI=1S/C16H11N.C11H8Br2.C7H6O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;12-10-4-8-6-1-2-7(3-6)9(8)5-11(10)13;8-6-7-4-2-1-3-5-7/h1-9H,17H2;1-2,4-7H,3H2;1-6H |
| InChIKey | UOBREGKKUMVZKT-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.39 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|