About 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol
2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol (PubChem CID 161146709) has the molecular formula C27H30O3
and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol.
Molecular Properties
| Compound Name | 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol |
| PubChem CID | 161146709 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol |
| SMILES | C=C(C)c1ccccc1O.C=CCc1ccc(O)cc1.C=CCc1cccc(O)c1 |
| InChI | InChI=1S/3C9H10O/c1-7(2)8-5-3-4-6-9(8)10;1-2-4-8-5-3-6-9(10)7-8;1-2-3-8-4-6-9(10)7-5-8/h3-6,10H,1H2,2H3;2-3,5-7,10H,1,4H2;2,4-7,10H,1,3H2 |
| InChIKey | UODMQYBAVCTRJI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol?
The IUPAC name of 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol (CID 161146709) is 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol.
What is the SMILES notation for 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol?
The canonical SMILES for 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol is C=C(C)c1ccccc1O.C=CCc1ccc(O)cc1.C=CCc1cccc(O)c1.
What is the InChIKey of 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol?
The InChIKey is UODMQYBAVCTRJI-UHFFFAOYSA-N. The full InChI is InChI=1S/3C9H10O/c1-7(2)8-5-3-4-6-9(8)10;1-2-4-8-5-3-6-9(10)7-8;1-2-3-8-4-6-9(10)7-5-8/h3-6,10H,1H2,2H3;2-3,5-7,10H,1,4H2;2,4-7,10H,1,3H2.
What are the key properties of 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol?
2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol has a molecular weight of 402.53 g/mol, XLogP of 6.67, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-en-2-ylphenol;3-prop-2-enylphenol;4-prop-2-enylphenol is sourced from PubChem (CID 161146709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).