About CID 161147503
CID 161147503 (PubChem CID 161147503) has the molecular formula C16H28FNO
and a molecular weight of 271.41 g/mol.
Molecular Properties
| Compound Name | CID 161147503 |
| PubChem CID | 161147503 |
| Molecular Formula | C16H28FNO |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.22 |
| IUPAC Name | — |
| SMILES | C.CC(C)c1ccc(OCCN2CCCC2)cc1.[3H]F |
| InChI | InChI=1S/C15H23NO.CH4.FH/c1-13(2)14-5-7-15(8-6-14)17-12-11-16-9-3-4-10-16;;/h5-8,13H,3-4,9-12H2,1-2H3;1H4;1H/i/hT |
| InChIKey | UOGCMMDXPJQHCV-MNYXATJNSA-N |
| XLogP | 4.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 161147503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161147503?
The IUPAC name of CID 161147503 (CID 161147503) is not available.
What is the SMILES notation for CID 161147503?
The canonical SMILES for CID 161147503 is C.CC(C)c1ccc(OCCN2CCCC2)cc1.[3H]F.
What is the InChIKey of CID 161147503?
The InChIKey is UOGCMMDXPJQHCV-MNYXATJNSA-N. The full InChI is InChI=1S/C15H23NO.CH4.FH/c1-13(2)14-5-7-15(8-6-14)17-12-11-16-9-3-4-10-16;;/h5-8,13H,3-4,9-12H2,1-2H3;1H4;1H/i/hT.
What are the key properties of CID 161147503?
CID 161147503 has a molecular weight of 271.41 g/mol, XLogP of 4.07, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161147503 is sourced from PubChem (CID 161147503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).