About N-(benzylideneamino)-N,2-dimethylaniline
N-(benzylideneamino)-N,2-dimethylaniline (PubChem CID 161148878) has the molecular formula C15H16N2
and a molecular weight of 224.31 g/mol. Its IUPAC name is N-(benzylideneamino)-N,2-dimethylaniline.
Molecular Properties
| Compound Name | N-(benzylideneamino)-N,2-dimethylaniline |
| PubChem CID | 161148878 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-(benzylideneamino)-N,2-dimethylaniline |
| SMILES | Cc1ccccc1N(C)N=Cc1ccccc1 |
| InChI | InChI=1S/C15H16N2/c1-13-8-6-7-11-15(13)17(2)16-12-14-9-4-3-5-10-14/h3-12H,1-2H3 |
| InChIKey | UOKIEUZBMJRQCA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(benzylideneamino)-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzylideneamino)-N,2-dimethylaniline?
The IUPAC name of N-(benzylideneamino)-N,2-dimethylaniline (CID 161148878) is N-(benzylideneamino)-N,2-dimethylaniline.
What is the SMILES notation for N-(benzylideneamino)-N,2-dimethylaniline?
The canonical SMILES for N-(benzylideneamino)-N,2-dimethylaniline is Cc1ccccc1N(C)N=Cc1ccccc1.
What is the InChIKey of N-(benzylideneamino)-N,2-dimethylaniline?
The InChIKey is UOKIEUZBMJRQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2/c1-13-8-6-7-11-15(13)17(2)16-12-14-9-4-3-5-10-14/h3-12H,1-2H3.
What are the key properties of N-(benzylideneamino)-N,2-dimethylaniline?
N-(benzylideneamino)-N,2-dimethylaniline has a molecular weight of 224.31 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzylideneamino)-N,2-dimethylaniline is sourced from PubChem (CID 161148878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).