About 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine
2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine (PubChem CID 161149045) has the molecular formula C13H8ClF10N5
and a molecular weight of 459.68 g/mol. Its IUPAC name is 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine.
Molecular Properties
| Compound Name | 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine |
| PubChem CID | 161149045 |
| Molecular Formula | C13H8ClF10N5 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine |
| SMILES | Cn1nc(-c2nc(Cl)ncc2C#N)c2ccccc21.FF.FF.FF.FF.FF |
| InChI | InChI=1S/C13H8ClN5.5F2/c1-19-10-5-3-2-4-9(10)12(18-19)11-8(6-15)7-16-13(14)17-11;5*1-2/h2-5,7H,1H3;;;;; |
| InChIKey | UOKTVYUPISIRSC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine?
The IUPAC name of 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine (CID 161149045) is 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine.
What is the SMILES notation for 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine?
The canonical SMILES for 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine is Cn1nc(-c2nc(Cl)ncc2C#N)c2ccccc21.FF.FF.FF.FF.FF.
What is the InChIKey of 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine?
The InChIKey is UOKTVYUPISIRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClN5.5F2/c1-19-10-5-3-2-4-9(10)12(18-19)11-8(6-15)7-16-13(14)17-11;5*1-2/h2-5,7H,1H3;;;;;.
What are the key properties of 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine?
2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine has a molecular weight of 459.68 g/mol, XLogP of 6.76, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1-methylindazol-3-yl)pyrimidine-5-carbonitrile;molecular fluorine is sourced from PubChem (CID 161149045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).