About (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane
(1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane (PubChem CID 161149630) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane.
Molecular Properties
| Compound Name | (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane |
| PubChem CID | 161149630 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane |
| SMILES | C.CC[C@H]1C[C@@H](Oc2ccncn2)C[C@@H]1O |
| InChI | InChI=1S/C11H16N2O2.CH4/c1-2-8-5-9(6-10(8)14)15-11-3-4-12-7-13-11;/h3-4,7-10,14H,2,5-6H2,1H3;1H4/t8-,9+,10-;/m0./s1 |
| InChIKey | UOMUQUXDCLQJAA-JYNKJOSWSA-N |
| XLogP | 2.04 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane?
The IUPAC name of (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane (CID 161149630) is (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane.
What is the SMILES notation for (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane?
The canonical SMILES for (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane is C.CC[C@H]1C[C@@H](Oc2ccncn2)C[C@@H]1O.
What is the InChIKey of (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane?
The InChIKey is UOMUQUXDCLQJAA-JYNKJOSWSA-N. The full InChI is InChI=1S/C11H16N2O2.CH4/c1-2-8-5-9(6-10(8)14)15-11-3-4-12-7-13-11;/h3-4,7-10,14H,2,5-6H2,1H3;1H4/t8-,9+,10-;/m0./s1.
What are the key properties of (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane?
(1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane has a molecular weight of 224.30 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S,4R)-2-ethyl-4-pyrimidin-4-yloxycyclopentan-1-ol;methane is sourced from PubChem (CID 161149630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).