About 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate
2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate (PubChem CID 161149763) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate.
Molecular Properties
| Compound Name | 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate |
| PubChem CID | 161149763 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate |
| SMILES | COC(=O)COC1CCC1.OCCOC1CCC1 |
| InChI | InChI=1S/C7H12O3.C6H12O2/c1-9-7(8)5-10-6-3-2-4-6;7-4-5-8-6-2-1-3-6/h6H,2-5H2,1H3;6-7H,1-5H2 |
| InChIKey | UONDWZYJPMAQQD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate?
The IUPAC name of 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate (CID 161149763) is 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate.
What is the SMILES notation for 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate?
The canonical SMILES for 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate is COC(=O)COC1CCC1.OCCOC1CCC1.
What is the InChIKey of 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate?
The InChIKey is UONDWZYJPMAQQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.C6H12O2/c1-9-7(8)5-10-6-3-2-4-6;7-4-5-8-6-2-1-3-6/h6H,2-5H2,1H3;6-7H,1-5H2.
What are the key properties of 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate?
2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate has a molecular weight of 260.33 g/mol, XLogP of 1.28, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyloxyethanol;methyl 2-cyclobutyloxyacetate is sourced from PubChem (CID 161149763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).