C56H77Cl2F4N5O6 — CID 161152944
CID 161152944 (PubChem CID 161152944) has the molecular formula C56H77Cl2F4N5O6 and a molecular weight of 1063.16 g/mol.
| Compound Name | CID 161152944 |
|---|---|
| PubChem CID | 161152944 |
| Molecular Formula | C56H77Cl2F4N5O6 |
| Molecular Weight | 1063.16 g/mol |
| Exact Mass | 1061.52 |
| IUPAC Name | — |
| SMILES | CC1=N[C@@]2(C(=O)N1CC(C)(C)F)c1cc(CC(=O)C(C)(C)F)ccc1CC21C[C@@H](C)C(O)[C@@H](C)C1.C[C@@H]1CC2(Cc3ccc(CC(=O)C(C)(C)F)cc3[C@]23N=C(N)N(CC(C)(C)F)C3=O)C[C@H](C)C1O.ClCCl |
| InChI | InChI=1S/C28H38F2N2O3.C27H37F2N3O3.CH2Cl2/c1-16-12-27(13-17(2)23(16)34)14-20-9-8-19(11-22(33)26(6,7)30)10-21(20)28(27)24(35)32(18(3)31-28)15-25(4,5)29;1-15-11-26(12-16(2)21(15)34)13-18-8-7-17(10-20(33)25(5,6)29)9-19(18)27(26)22(35)32(23(30)31-27)14-24(3,4)28;2-1-3/h8-10,16-17,23,34H,11-15H2,1-7H3;7-9,15-16,21,34H,10-14H2,1-6H3,(H2,30,31);1H2/t16-,17+,23?,27?,28-;15-,16+,21?,26?,27-;/m11./s1 |
| InChIKey | UOXOQLVVINBVRZ-XXZHUQMYSA-N |
| XLogP | 9.76 |
| TPSA | 165.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.16 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|