C27H38O6S — CID 161153593
cis-(2R,3R)-2-(benzenesulfonyl)-2-methyl-3-(2-oxopropyl)cyclohexan-1-one;(E)-9-methyldec-3-ene-2,8-dione (PubChem CID 161153593) has the molecular formula C27H38O6S and a molecular weight of 490.66 g/mol. Its IUPAC name is cis-(2R,3R)-2-(benzenesulfonyl)-2-methyl-3-(2-oxopropyl)cyclohexan-1-one;(E)-9-methyldec-3-ene-2,8-dione.
| Compound Name | cis-(2R,3R)-2-(benzenesulfonyl)-2-methyl-3-(2-oxopropyl)cyclohexan-1-one;(E)-9-methyldec-3-ene-2,8-dione |
|---|---|
| PubChem CID | 161153593 |
| Molecular Formula | C27H38O6S |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | cis-(2R,3R)-2-(benzenesulfonyl)-2-methyl-3-(2-oxopropyl)cyclohexan-1-one;(E)-9-methyldec-3-ene-2,8-dione |
| SMILES | CC(=O)/C=C/CCCC(=O)C(C)C.CC(=O)C[C@H]1CCCC(=O)[C@]1(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O4S.C11H18O2/c1-12(17)11-13-7-6-10-15(18)16(13,2)21(19,20)14-8-4-3-5-9-14;1-9(2)11(13)8-6-4-5-7-10(3)12/h3-5,8-9,13H,6-7,10-11H2,1-2H3;5,7,9H,4,6,8H2,1-3H3/b;7-5+/t13-,16-;/m1./s1 |
| InChIKey | UOZVYVRWYJKHJS-SSIGYUGPSA-N |
| XLogP | 5.09 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|