About 2,3-di(propan-2-yl)thiophene;ethane;methane
2,3-di(propan-2-yl)thiophene;ethane;methane (PubChem CID 161153650) has the molecular formula C13H26S
and a molecular weight of 214.42 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)thiophene;ethane;methane.
Molecular Properties
| Compound Name | 2,3-di(propan-2-yl)thiophene;ethane;methane |
| PubChem CID | 161153650 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2,3-di(propan-2-yl)thiophene;ethane;methane |
| SMILES | C.CC.CC(C)c1ccsc1C(C)C |
| InChI | InChI=1S/C10H16S.C2H6.CH4/c1-7(2)9-5-6-11-10(9)8(3)4;1-2;/h5-8H,1-4H3;1-2H3;1H4 |
| InChIKey | UPAAKLUFJWTKQG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-di(propan-2-yl)thiophene;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-di(propan-2-yl)thiophene;ethane;methane?
The IUPAC name of 2,3-di(propan-2-yl)thiophene;ethane;methane (CID 161153650) is 2,3-di(propan-2-yl)thiophene;ethane;methane.
What is the SMILES notation for 2,3-di(propan-2-yl)thiophene;ethane;methane?
The canonical SMILES for 2,3-di(propan-2-yl)thiophene;ethane;methane is C.CC.CC(C)c1ccsc1C(C)C.
What is the InChIKey of 2,3-di(propan-2-yl)thiophene;ethane;methane?
The InChIKey is UPAAKLUFJWTKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S.C2H6.CH4/c1-7(2)9-5-6-11-10(9)8(3)4;1-2;/h5-8H,1-4H3;1-2H3;1H4.
What are the key properties of 2,3-di(propan-2-yl)thiophene;ethane;methane?
2,3-di(propan-2-yl)thiophene;ethane;methane has a molecular weight of 214.42 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-di(propan-2-yl)thiophene;ethane;methane is sourced from PubChem (CID 161153650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).