C13H26S — CID 161153650
2,3-di(propan-2-yl)thiophene;ethane;methane (PubChem CID 161153650) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is 2,3-di(propan-2-yl)thiophene;ethane;methane.
| Compound Name | 2,3-di(propan-2-yl)thiophene;ethane;methane |
|---|---|
| PubChem CID | 161153650 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2,3-di(propan-2-yl)thiophene;ethane;methane |
| SMILES | C.CC.CC(C)c1ccsc1C(C)C |
| InChI | InChI=1S/C10H16S.C2H6.CH4/c1-7(2)9-5-6-11-10(9)8(3)4;1-2;/h5-8H,1-4H3;1-2H3;1H4 |
| InChIKey | UPAAKLUFJWTKQG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |