C15H29F3OSi — CID 161155158
tert-butyl-dimethyl-[(Z,4R)-9,9,9-trifluoronon-6-en-4-yl]oxysilane (PubChem CID 161155158) has the molecular formula C15H29F3OSi and a molecular weight of 310.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,4R)-9,9,9-trifluoronon-6-en-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(Z,4R)-9,9,9-trifluoronon-6-en-4-yl]oxysilane |
|---|---|
| PubChem CID | 161155158 |
| Molecular Formula | C15H29F3OSi |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,4R)-9,9,9-trifluoronon-6-en-4-yl]oxysilane |
| SMILES | CCC[C@H](C/C=C\CC(F)(F)F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29F3OSi/c1-7-10-13(11-8-9-12-15(16,17)18)19-20(5,6)14(2,3)4/h8-9,13H,7,10-12H2,1-6H3/b9-8-/t13-/m1/s1 |
| InChIKey | UPEVIHMSKRKMIG-LJTDUEICSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|