About N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine
N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine (PubChem CID 161155407) has the molecular formula C14H14F2N2O3
and a molecular weight of 296.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine |
| PubChem CID | 161155407 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine |
| SMILES | CC(=O)N(O)c1ccc(F)cc1.ONc1ccc(F)cc1 |
| InChI | InChI=1S/C8H8FNO2.C6H6FNO/c1-6(11)10(12)8-4-2-7(9)3-5-8;7-5-1-3-6(8-9)4-2-5/h2-5,12H,1H3;1-4,8-9H |
| InChIKey | UPFPPIQHDVYKEH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine?
The IUPAC name of N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine (CID 161155407) is N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine.
What is the SMILES notation for N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine?
The canonical SMILES for N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine is CC(=O)N(O)c1ccc(F)cc1.ONc1ccc(F)cc1.
What is the InChIKey of N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine?
The InChIKey is UPFPPIQHDVYKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNO2.C6H6FNO/c1-6(11)10(12)8-4-2-7(9)3-5-8;7-5-1-3-6(8-9)4-2-5/h2-5,12H,1H3;1-4,8-9H.
What are the key properties of N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine?
N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine has a molecular weight of 296.27 g/mol, XLogP of 3.19, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N-hydroxyacetamide;N-(4-fluorophenyl)hydroxylamine is sourced from PubChem (CID 161155407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).