C21H22N8O — CID 161155685
2-[7-(1-methyltriazol-4-yl)quinazolin-2-yl]-1-(1-piperidin-4-ylpyrazol-4-yl)ethanone (PubChem CID 161155685) has the molecular formula C21H22N8O and a molecular weight of 402.46 g/mol. Its IUPAC name is 2-[7-(1-methyltriazol-4-yl)quinazolin-2-yl]-1-(1-piperidin-4-ylpyrazol-4-yl)ethanone.
| Compound Name | 2-[7-(1-methyltriazol-4-yl)quinazolin-2-yl]-1-(1-piperidin-4-ylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 161155685 |
| Molecular Formula | C21H22N8O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[7-(1-methyltriazol-4-yl)quinazolin-2-yl]-1-(1-piperidin-4-ylpyrazol-4-yl)ethanone |
| SMILES | Cn1cc(-c2ccc3cnc(CC(=O)c4cnn(C5CCNCC5)c4)nc3c2)nn1 |
| InChI | InChI=1S/C21H22N8O/c1-28-13-19(26-27-28)14-2-3-15-10-23-21(25-18(15)8-14)9-20(30)16-11-24-29(12-16)17-4-6-22-7-5-17/h2-3,8,10-13,17,22H,4-7,9H2,1H3 |
| InChIKey | UPGLEVVBWVBOMG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |