About 2-methylbutane;1H-1,2,4-triazole
2-methylbutane;1H-1,2,4-triazole (PubChem CID 161155830) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 2-methylbutane;1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 2-methylbutane;1H-1,2,4-triazole |
| PubChem CID | 161155830 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 2-methylbutane;1H-1,2,4-triazole |
| SMILES | CCC(C)C.c1nc[nH]n1 |
| InChI | InChI=1S/C5H12.C2H3N3/c1-4-5(2)3;1-3-2-5-4-1/h5H,4H2,1-3H3;1-2H,(H,3,4,5) |
| InChIKey | UPGWZXHNCCGIQV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutane;1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;1H-1,2,4-triazole?
The IUPAC name of 2-methylbutane;1H-1,2,4-triazole (CID 161155830) is 2-methylbutane;1H-1,2,4-triazole.
What is the SMILES notation for 2-methylbutane;1H-1,2,4-triazole?
The canonical SMILES for 2-methylbutane;1H-1,2,4-triazole is CCC(C)C.c1nc[nH]n1.
What is the InChIKey of 2-methylbutane;1H-1,2,4-triazole?
The InChIKey is UPGWZXHNCCGIQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.C2H3N3/c1-4-5(2)3;1-3-2-5-4-1/h5H,4H2,1-3H3;1-2H,(H,3,4,5).
What are the key properties of 2-methylbutane;1H-1,2,4-triazole?
2-methylbutane;1H-1,2,4-triazole has a molecular weight of 141.22 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;1H-1,2,4-triazole is sourced from PubChem (CID 161155830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).