C29H24F11N3O2 — CID 161156978
4-fluorobenzonitrile;4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine (PubChem CID 161156978) has the molecular formula C29H24F11N3O2 and a molecular weight of 655.51 g/mol. Its IUPAC name is 4-fluorobenzonitrile;4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine.
| Compound Name | 4-fluorobenzonitrile;4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine |
|---|---|
| PubChem CID | 161156978 |
| Molecular Formula | C29H24F11N3O2 |
| Molecular Weight | 655.51 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | 4-fluorobenzonitrile;4-(3,3,4,4,4-pentafluorobutan-2-yloxy)benzonitrile;[4-(3,3,4,4,4-pentafluorobutan-2-yloxy)phenyl]methanamine |
| SMILES | CC(Oc1ccc(C#N)cc1)C(F)(F)C(F)(F)F.CC(Oc1ccc(CN)cc1)C(F)(F)C(F)(F)F.N#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H12F5NO.C11H8F5NO.C7H4FN/c2*1-7(10(12,13)11(14,15)16)18-9-4-2-8(6-17)3-5-9;8-7-3-1-6(5-9)2-4-7/h2-5,7H,6,17H2,1H3;2-5,7H,1H3;1-4H |
| InChIKey | UPKOPQJPYREFCP-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.51 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|