hydrogen peroxide;(phenyldiselanyl)benzene

C12H12O2Se2 — CID 161157023

IUPAChydrogen peroxide;(phenyldiselanyl)benzene
SMILESOO.c1ccc([Se][Se]c2ccccc2)cc1
InChIInChI=1S/C12H10Se2.H2O2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-2/h1-10H;1-2H
InChIKeyUPKSVKAIICNTOI-UHFFFAOYSA-N
MW346.15 g/mol
LogP0.98
Rot. Bonds3

About hydrogen peroxide;(phenyldiselanyl)benzene

hydrogen peroxide;(phenyldiselanyl)benzene (PubChem CID 161157023) has the molecular formula C12H12O2Se2 and a molecular weight of 346.15 g/mol. Its IUPAC name is hydrogen peroxide;(phenyldiselanyl)benzene.

Molecular Properties

Compound Namehydrogen peroxide;(phenyldiselanyl)benzene
PubChem CID161157023
Molecular FormulaC12H12O2Se2
Molecular Weight346.15 g/mol
Exact Mass347.92
IUPAC Namehydrogen peroxide;(phenyldiselanyl)benzene
SMILESOO.c1ccc([Se][Se]c2ccccc2)cc1
InChIInChI=1S/C12H10Se2.H2O2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-2/h1-10H;1-2H
InChIKeyUPKSVKAIICNTOI-UHFFFAOYSA-N
XLogP0.98
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.15
LogP ≤ 50.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}

Analyze hydrogen peroxide;(phenyldiselanyl)benzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen peroxide;(phenyldiselanyl)benzene?
The IUPAC name of hydrogen peroxide;(phenyldiselanyl)benzene (CID 161157023) is hydrogen peroxide;(phenyldiselanyl)benzene.
What is the SMILES notation for hydrogen peroxide;(phenyldiselanyl)benzene?
The canonical SMILES for hydrogen peroxide;(phenyldiselanyl)benzene is OO.c1ccc([Se][Se]c2ccccc2)cc1.
What is the InChIKey of hydrogen peroxide;(phenyldiselanyl)benzene?
The InChIKey is UPKSVKAIICNTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Se2.H2O2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;1-2/h1-10H;1-2H.
What are the key properties of hydrogen peroxide;(phenyldiselanyl)benzene?
hydrogen peroxide;(phenyldiselanyl)benzene has a molecular weight of 346.15 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;(phenyldiselanyl)benzene is sourced from PubChem (CID 161157023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).