About ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium
ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium (PubChem CID 161158486) has the molecular formula C23H46N2V
and a molecular weight of 401.58 g/mol. Its IUPAC name is ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium.
Molecular Properties
| Compound Name | ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium |
| PubChem CID | 161158486 |
| Molecular Formula | C23H46N2V |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium |
| SMILES | CC.CC.CC.CC.CCN1CCC(N2CCc3ccccc32)CC1.[V] |
| InChI | InChI=1S/C15H22N2.4C2H6.V/c1-2-16-10-8-14(9-11-16)17-12-7-13-5-3-4-6-15(13)17;4*1-2;/h3-6,14H,2,7-12H2,1H3;4*1-2H3; |
| InChIKey | UPPOFDWRTDBJSD-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium?
The IUPAC name of ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium (CID 161158486) is ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium.
What is the SMILES notation for ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium?
The canonical SMILES for ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium is CC.CC.CC.CC.CCN1CCC(N2CCc3ccccc32)CC1.[V].
What is the InChIKey of ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium?
The InChIKey is UPPOFDWRTDBJSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2.4C2H6.V/c1-2-16-10-8-14(9-11-16)17-12-7-13-5-3-4-6-15(13)17;4*1-2;/h3-6,14H,2,7-12H2,1H3;4*1-2H3;.
What are the key properties of ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium?
ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium has a molecular weight of 401.58 g/mol, XLogP of 6.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(1-ethylpiperidin-4-yl)-2,3-dihydroindole;vanadium is sourced from PubChem (CID 161158486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).