C24H26Cl2N4O3 — CID 161159122
1-(4-chlorophenyl)piperidin-4-one;8-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 161159122) has the molecular formula C24H26Cl2N4O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is 1-(4-chlorophenyl)piperidin-4-one;8-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)piperidin-4-one;8-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 161159122 |
| Molecular Formula | C24H26Cl2N4O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1-(4-chlorophenyl)piperidin-4-one;8-(4-chlorophenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1CCN(c2ccc(Cl)cc2)CC1.O=C1NC(=O)C2(CCN(c3ccc(Cl)cc3)CC2)N1 |
| InChI | InChI=1S/C13H14ClN3O2.C11H12ClNO/c14-9-1-3-10(4-2-9)17-7-5-13(6-8-17)11(18)15-12(19)16-13;12-9-1-3-10(4-2-9)13-7-5-11(14)6-8-13/h1-4H,5-8H2,(H2,15,16,18,19);1-4H,5-8H2 |
| InChIKey | UPRRUZZBEHZTSD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|