About 2-diethoxyphosphorylbenzaldehyde;toluene
2-diethoxyphosphorylbenzaldehyde;toluene (PubChem CID 161160317) has the molecular formula C18H23O4P
and a molecular weight of 334.35 g/mol. Its IUPAC name is 2-diethoxyphosphorylbenzaldehyde;toluene.
Molecular Properties
| Compound Name | 2-diethoxyphosphorylbenzaldehyde;toluene |
| PubChem CID | 161160317 |
| Molecular Formula | C18H23O4P |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-diethoxyphosphorylbenzaldehyde;toluene |
| SMILES | CCOP(=O)(OCC)c1ccccc1C=O.Cc1ccccc1 |
| InChI | InChI=1S/C11H15O4P.C7H8/c1-3-14-16(13,15-4-2)11-8-6-5-7-10(11)9-12;1-7-5-3-2-4-6-7/h5-9H,3-4H2,1-2H3;2-6H,1H3 |
| InChIKey | UPVJNKLNYLIFSZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diethoxyphosphorylbenzaldehyde;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diethoxyphosphorylbenzaldehyde;toluene?
The IUPAC name of 2-diethoxyphosphorylbenzaldehyde;toluene (CID 161160317) is 2-diethoxyphosphorylbenzaldehyde;toluene.
What is the SMILES notation for 2-diethoxyphosphorylbenzaldehyde;toluene?
The canonical SMILES for 2-diethoxyphosphorylbenzaldehyde;toluene is CCOP(=O)(OCC)c1ccccc1C=O.Cc1ccccc1.
What is the InChIKey of 2-diethoxyphosphorylbenzaldehyde;toluene?
The InChIKey is UPVJNKLNYLIFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15O4P.C7H8/c1-3-14-16(13,15-4-2)11-8-6-5-7-10(11)9-12;1-7-5-3-2-4-6-7/h5-9H,3-4H2,1-2H3;2-6H,1H3.
What are the key properties of 2-diethoxyphosphorylbenzaldehyde;toluene?
2-diethoxyphosphorylbenzaldehyde;toluene has a molecular weight of 334.35 g/mol, XLogP of 4.39, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diethoxyphosphorylbenzaldehyde;toluene is sourced from PubChem (CID 161160317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).