About acenaphthylene;dibromonickel
acenaphthylene;dibromonickel (PubChem CID 161160436) has the molecular formula C12H8Br2Ni
and a molecular weight of 370.70 g/mol. Its IUPAC name is acenaphthylene;dibromonickel.
Molecular Properties
| Compound Name | acenaphthylene;dibromonickel |
| PubChem CID | 161160436 |
| Molecular Formula | C12H8Br2Ni |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 367.83 |
| IUPAC Name | acenaphthylene;dibromonickel |
| SMILES | Br[Ni]Br.C1=Cc2cccc3cccc1c23 |
| InChI | InChI=1S/C12H8.2BrH.Ni/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;;;/h1-8H;2*1H;/q;;;+2/p-2 |
| InChIKey | UPVSVSWBAWRUKT-UHFFFAOYSA-L |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze acenaphthylene;dibromonickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acenaphthylene;dibromonickel?
The IUPAC name of acenaphthylene;dibromonickel (CID 161160436) is acenaphthylene;dibromonickel.
What is the SMILES notation for acenaphthylene;dibromonickel?
The canonical SMILES for acenaphthylene;dibromonickel is Br[Ni]Br.C1=Cc2cccc3cccc1c23.
What is the InChIKey of acenaphthylene;dibromonickel?
The InChIKey is UPVSVSWBAWRUKT-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8.2BrH.Ni/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11;;;/h1-8H;2*1H;/q;;;+2/p-2.
What are the key properties of acenaphthylene;dibromonickel?
acenaphthylene;dibromonickel has a molecular weight of 370.70 g/mol, XLogP of 5.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acenaphthylene;dibromonickel is sourced from PubChem (CID 161160436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).