About 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one
8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one (PubChem CID 161160908) has the molecular formula C18H13Cl2IO4
and a molecular weight of 491.11 g/mol. Its IUPAC name is 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one |
| PubChem CID | 161160908 |
| Molecular Formula | C18H13Cl2IO4 |
| Molecular Weight | 491.11 g/mol |
| Exact Mass | 489.92 |
| IUPAC Name | 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one |
| SMILES | O=C1CCOc2c(Cl)cc(I)cc21.O=C1CCOc2c(Cl)cccc21 |
| InChI | InChI=1S/C9H6ClIO2.C9H7ClO2/c10-7-4-5(11)3-6-8(12)1-2-13-9(6)7;10-7-3-1-2-6-8(11)4-5-12-9(6)7/h3-4H,1-2H2;1-3H,4-5H2 |
| InChIKey | UPXFAKMCFHGPIU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.11 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one?
The IUPAC name of 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one (CID 161160908) is 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one.
What is the SMILES notation for 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one?
The canonical SMILES for 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one is O=C1CCOc2c(Cl)cc(I)cc21.O=C1CCOc2c(Cl)cccc21.
What is the InChIKey of 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one?
The InChIKey is UPXFAKMCFHGPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClIO2.C9H7ClO2/c10-7-4-5(11)3-6-8(12)1-2-13-9(6)7;10-7-3-1-2-6-8(11)4-5-12-9(6)7/h3-4H,1-2H2;1-3H,4-5H2.
What are the key properties of 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one?
8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one has a molecular weight of 491.11 g/mol, XLogP of 5.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2,3-dihydrochromen-4-one;8-chloro-6-iodo-2,3-dihydrochromen-4-one is sourced from PubChem (CID 161160908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).