C56H52N4O4 — CID 161161479
methyl 1-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate;methyl 3-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate (PubChem CID 161161479) has the molecular formula C56H52N4O4 and a molecular weight of 845.06 g/mol. Its IUPAC name is methyl 1-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate;methyl 3-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate.
| Compound Name | methyl 1-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate;methyl 3-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 161161479 |
| Molecular Formula | C56H52N4O4 |
| Molecular Weight | 845.06 g/mol |
| Exact Mass | 844.40 |
| IUPAC Name | methyl 1-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate;methyl 3-trityl-4,5,6,7-tetrahydrobenzimidazole-5-carboxylate |
| SMILES | COC(=O)C1CCc2c(ncn2C(c2ccccc2)(c2ccccc2)c2ccccc2)C1.COC(=O)C1CCc2ncn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2C1 |
| InChI | InChI=1S/2C28H26N2O2/c1-32-27(31)21-17-18-26-25(19-21)29-20-30(26)28(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24;1-32-27(31)21-17-18-25-26(19-21)30(20-29-25)28(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2*2-16,20-21H,17-19H2,1H3 |
| InChIKey | UPZDEHUKPNOWPO-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.06 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|